CAS 3284-52-4 is the registry number for ethyl 3–hydroxy–3–methyl–1–tosylpyrrolidine–2–carboxylate. Offered by: GLPBio. Available pack sizes: 200mg.
Ethyl 3-hydroxy-3-methyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (CAS 3284-52-4) is a chemical compound with the molecular formula C15H21NO5S and a molecular weight of 327.4 g/mol. IUPAC name: ethyl 3-hydroxy-3-methyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate. InChIKey: DUJJLVJTVQPWIJ-UHFFFAOYSA-N.
| Molecular formula | C15H21NO5S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | ethyl 3-hydroxy-3-methyl-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| InChIKey | DUJJLVJTVQPWIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(CCN1S(=O)(=O)C2=CC=C(C=C2)C)(C)O |
Computed by PubChem (NCBI)