CAS 2756104-03-5 is the registry number for Benzyl (2R)-2-[(methanesulfonyloxy)methyl]-2-methylpyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl (2R)-2-methyl-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (CAS 2756104-03-5) is a chemical compound with the molecular formula C15H21NO5S and a molecular weight of 327.4 g/mol. IUPAC name: benzyl (2R)-2-methyl-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate. InChIKey: VQINTHQUKSWJDJ-OAHLLOKOSA-N.
| Molecular formula | C15H21NO5S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | benzyl (2R)-2-methyl-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | VQINTHQUKSWJDJ-OAHLLOKOSA-N |
| SMILES | C[C@@]1(CCCN1C(=O)OCC2=CC=CC=C2)COS(=O)(=O)C |
Computed by PubChem (NCBI)