CAS 1159822-71-5 appears in our catalog under these names: 1-Benzyl-1,7-diaza-spiro[4.4]nonane dihydrochloride, 95%, 1-Benzyl-1,7-diazaspiro(4.4)nonane dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-benzyl-1,7-diazaspiro[4.4]nonane;dihydrochloride (CAS 1159822-71-5) is a chemical compound with the molecular formula C14H22Cl2N2 and a molecular weight of 289.2 g/mol. IUPAC name: 1-benzyl-1,7-diazaspiro[4.4]nonane;dihydrochloride. InChIKey: CSYVROLHNYLECJ-UHFFFAOYSA-N.
| Molecular formula | C14H22Cl2N2 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 1-benzyl-1,7-diazaspiro[4.4]nonane;dihydrochloride |
| InChIKey | CSYVROLHNYLECJ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCNC2)N(C1)CC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)