CAS 2140866-84-6 is the registry number for 6-(Piperidin-4-yl)-1,2,3,4-tetrahydroquinoline dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-piperidin-4-yl-1,2,3,4-tetrahydroquinoline;dihydrochloride (CAS 2140866-84-6) is a chemical compound with the molecular formula C14H22Cl2N2 and a molecular weight of 289.2 g/mol. IUPAC name: 6-piperidin-4-yl-1,2,3,4-tetrahydroquinoline;dihydrochloride. InChIKey: FINARFSESBYJJN-UHFFFAOYSA-N.
| Molecular formula | C14H22Cl2N2 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 6-piperidin-4-yl-1,2,3,4-tetrahydroquinoline;dihydrochloride |
| InChIKey | FINARFSESBYJJN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C3CCNCC3)NC1.Cl.Cl |
Computed by PubChem (NCBI)