CAS 2102933-95-7 appears in our catalog under these names: GSK LSD1 Dihydrochloride, GSK-LSD1 dihydrochloride/ 99.22% (existing batch purity), GSK–LSD1 (hydrochloride), GSK–LSD1 Dihydrochloride, GSK-LSD1 dihydrochloride. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 500mg.
N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride (CAS 2102933-95-7) is a chemical compound with the molecular formula C14H22Cl2N2 and a molecular weight of 289.2 g/mol. IUPAC name: N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride. InChIKey: PJFZOGMSPBHPNS-WICJZZOFSA-N.
| Molecular formula | C14H22Cl2N2 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride |
| InChIKey | PJFZOGMSPBHPNS-WICJZZOFSA-N |
| SMILES | C1CNCCC1N[C@@H]2C[C@H]2C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)