Products 1821798-25-7
CAS 1821798-25-7 is the registry number for Gsk-lsd1 dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride (CAS 1821798-25-7) is a chemical compound with the molecular formula C14H22Cl2N2 and a molecular weight of 289.2 g/mol. IUPAC name: N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride. InChIKey: PJFZOGMSPBHPNS-WICJZZOFSA-N.
| Molecular formula | C14H22Cl2N2 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride |
| InChIKey | PJFZOGMSPBHPNS-WICJZZOFSA-N |
| SMILES | C1CNCCC1N[C@@H]2C[C@H]2C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
GSK-LSD1 Dihydrochloride, GSK-LSD1 (hydrochloride), GSK-LSD1 2HCl, GSK-LSD1 (dihydrochloride), N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride, N-((1R,2S)-2-phenylcyclopropyl)piperidin-4-amine dihydrochloride, GSK LSD 1 dihydrochloride, 1821798-25-7 (2HCl), orb1223305, orb1305713