CAS 1159826-19-3 is the registry number for 2-(1-Methyl-1H-indol-3-yl)-ethylamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 5000mg.
2-(1-methylindol-3-yl)ethanamine;dihydrochloride (CAS 1159826-19-3) is a chemical compound with the molecular formula C11H16Cl2N2 and a molecular weight of 247.16 g/mol. IUPAC name: 2-(1-methylindol-3-yl)ethanamine;dihydrochloride. InChIKey: LUZBWUSDPOXPTO-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2 |
|---|---|
| Molecular weight | 247.16 g/mol |
| IUPAC name | 2-(1-methylindol-3-yl)ethanamine;dihydrochloride |
| InChIKey | LUZBWUSDPOXPTO-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)CCN.Cl.Cl |
Computed by PubChem (NCBI)