Products 1159831-05-6

CAS 1159831-05-6 is the registry number for 8-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

8-bromoimidazo[1,5-a]pyridine-3-carboxylic acid (CAS 1159831-05-6) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 8-bromoimidazo[1,5-a]pyridine-3-carboxylic acid. InChIKey: LRPFOCNXINLEEL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrN2O2
Molecular weight241.04 g/mol
IUPAC name8-bromoimidazo[1,5-a]pyridine-3-carboxylic acid
InChIKeyLRPFOCNXINLEEL-UHFFFAOYSA-N
SMILESC1=CN2C(=CN=C2C(=O)O)C(=C1)Br

Computed by PubChem (NCBI)