CAS 1159831-05-6 is the registry number for 8-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromoimidazo[1,5-a]pyridine-3-carboxylic acid (CAS 1159831-05-6) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 8-bromoimidazo[1,5-a]pyridine-3-carboxylic acid. InChIKey: LRPFOCNXINLEEL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 8-bromoimidazo[1,5-a]pyridine-3-carboxylic acid |
| InChIKey | LRPFOCNXINLEEL-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=O)O)C(=C1)Br |
Computed by PubChem (NCBI)