Products 1159983-10-4
CAS 1159983-10-4 is the registry number for 5,7-Dichloro-3-ethyl-2-methylpyrazolo[1,5-a]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-3-ethyl-2-methylpyrazolo[1,5-a]pyrimidine (CAS 1159983-10-4) is a chemical compound with the molecular formula C9H9Cl2N3 and a molecular weight of 230.09 g/mol. IUPAC name: 5,7-dichloro-3-ethyl-2-methylpyrazolo[1,5-a]pyrimidine. InChIKey: NWMWFPOLNWGRSS-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3 |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 5,7-dichloro-3-ethyl-2-methylpyrazolo[1,5-a]pyrimidine |
| InChIKey | NWMWFPOLNWGRSS-UHFFFAOYSA-N |
| SMILES | CCC1=C2N=C(C=C(N2N=C1C)Cl)Cl |
Computed by PubChem (NCBI)