CAS 65146-57-8 is the registry number for 5-(4-Chlorophenyl)-1h-imidazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 250mg, 5g.
5-(4-chlorophenyl)-1H-imidazol-2-amine;hydrochloride (CAS 65146-57-8) is a chemical compound with the molecular formula C9H9Cl2N3 and a molecular weight of 230.09 g/mol. IUPAC name: 5-(4-chlorophenyl)-1H-imidazol-2-amine;hydrochloride. InChIKey: VRZFLRVEEMVQEE-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3 |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1H-imidazol-2-amine;hydrochloride |
| InChIKey | VRZFLRVEEMVQEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N2)N)Cl.Cl |
Computed by PubChem (NCBI)