Products 13215-67-3
CAS 13215-67-3 is the registry number for 5-(4-Chlorophenyl)-1H-pyrazol-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-chlorophenyl)-1H-pyrazol-3-amine;hydrochloride (CAS 13215-67-3) is a chemical compound with the molecular formula C9H9Cl2N3 and a molecular weight of 230.09 g/mol. IUPAC name: 5-(4-chlorophenyl)-1H-pyrazol-3-amine;hydrochloride. InChIKey: VQTYSUCAYGUZHG-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3 |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | VQTYSUCAYGUZHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NN2)N)Cl.Cl |
Computed by PubChem (NCBI)