CAS 2769718-11-6 is the registry number for 4,6-Dichloro-1-ethyl-3-methyl-1H-pyrazolo[4,3-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-1-ethyl-3-methylpyrazolo[4,3-c]pyridine (CAS 2769718-11-6) is a chemical compound with the molecular formula C9H9Cl2N3 and a molecular weight of 230.09 g/mol. IUPAC name: 4,6-dichloro-1-ethyl-3-methylpyrazolo[4,3-c]pyridine. InChIKey: VHDJYJZEALZGJA-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3 |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 4,6-dichloro-1-ethyl-3-methylpyrazolo[4,3-c]pyridine |
| InChIKey | VHDJYJZEALZGJA-UHFFFAOYSA-N |
| SMILES | CCN1C2=CC(=NC(=C2C(=N1)C)Cl)Cl |
Computed by PubChem (NCBI)