Products 2382914-88-5
CAS 2382914-88-5 is the registry number for 2,4-Dichloro-5-propyl-5H-pyrrolo[3,2-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-5-propylpyrrolo[3,2-d]pyrimidine (CAS 2382914-88-5) is a chemical compound with the molecular formula C9H9Cl2N3 and a molecular weight of 230.09 g/mol. IUPAC name: 2,4-dichloro-5-propylpyrrolo[3,2-d]pyrimidine. InChIKey: ZGCUUMKXSWAGCA-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3 |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 2,4-dichloro-5-propylpyrrolo[3,2-d]pyrimidine |
| InChIKey | ZGCUUMKXSWAGCA-UHFFFAOYSA-N |
| SMILES | CCCN1C=CC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)