CAS 1160187-62-1 appears in our catalog under these names: tert-Butyl ((3R,4R)-4-hydroxytetrahydrofuran-3-yl)carbamate, 98%, tert-Butyl ((3R,4R)-4-hydroxytetrahydrofuran-3-yl)carbamate 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
Tert-butyl N-[(3R,4R)-4-hydroxyoxolan-3-yl]carbamate (CAS 1160187-62-1) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-4-hydroxyoxolan-3-yl]carbamate. InChIKey: SFIADDJLFYFDGK-RQJHMYQMSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-4-hydroxyoxolan-3-yl]carbamate |
| InChIKey | SFIADDJLFYFDGK-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC[C@@H]1O |
Computed by PubChem (NCBI)