CAS 104072-49-3 is the registry number for 1-tert-butyl 4-methyl (2S)-2-aminobutanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-O-tert-butyl 4-O-methyl (2S)-2-aminobutanedioate (CAS 104072-49-3) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (2S)-2-aminobutanedioate. InChIKey: WNJFEWOMTHUJAP-LURJTMIESA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (2S)-2-aminobutanedioate |
| InChIKey | WNJFEWOMTHUJAP-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)OC)N |
Computed by PubChem (NCBI)