CAS 159991-23-8 appears in our catalog under these names: (R)-N-Boc-3-aminobutyric acid, 97%, Boc-D-beta-HAla-OH, Boc-D-3-Abu-OH, 98%, 98%, Boc-D-3-Abu-OH, 95%. Offered by: Combi-blocks, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 50g, 500g, 250g.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 159991-23-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PYNDHEONPQYIAN-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PYNDHEONPQYIAN-ZCFIWIBFSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)