CAS 1160188-05-5 is the registry number for 5-Oxohexyl Biotin. Offered by: TRC. Available pack sizes: 250mg.
(3aS,6aR)-4-(5-oxohexyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (CAS 1160188-05-5) is a chemical compound with the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. IUPAC name: (3aS,6aR)-4-(5-oxohexyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one. InChIKey: YPKZJRGKHXINPU-SMILAEQMSA-N.
| Molecular formula | C11H18N2O2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | (3aS,6aR)-4-(5-oxohexyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| InChIKey | YPKZJRGKHXINPU-SMILAEQMSA-N |
| SMILES | CC(=O)CCCCC1[C@@H]2[C@H](CS1)NC(=O)N2 |
Computed by PubChem (NCBI)