CAS 1160264-11-8 appears in our catalog under these names: 1-Methyl-2-oxo-2-phenylethyl 4-aminobenzoate, 95%, 1-Oxo-1-phenylpropan-2-yl 4-aminobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(1-oxo-1-phenylpropan-2-yl) 4-aminobenzoate (CAS 1160264-11-8) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: (1-oxo-1-phenylpropan-2-yl) 4-aminobenzoate. InChIKey: ZCEZRWHJATUUOH-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | (1-oxo-1-phenylpropan-2-yl) 4-aminobenzoate |
| InChIKey | ZCEZRWHJATUUOH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=CC=C1)OC(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)