CAS 1160264-86-7 appears in our catalog under these names: 2-(3,4-Dimethoxyphenyl)quinoline-4-carbonyl chloride, 95%, 2-(3,4-Dimethoxyphenyl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl chloride (CAS 1160264-86-7) is a chemical compound with the molecular formula C18H14ClNO3 and a molecular weight of 327.8 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl chloride. InChIKey: NCJWOQWMURNTIU-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO3 |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl chloride |
| InChIKey | NCJWOQWMURNTIU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)Cl)OC |
Computed by PubChem (NCBI)