CAS 137-52-0 appears in our catalog under these names: N-(5-Chloro-2-methoxyphenyl)-3-hydroxynaphthalene-2-carboxamide, 98%, N-(5-Chloro-2-methoxyphenyl)-3-hydroxy-2-naphthamide 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 100g, 25g, 1g.
N-(5-chloro-2-methoxyphenyl)-3-hydroxynaphthalene-2-carboxamide (CAS 137-52-0) is a chemical compound with the molecular formula C18H14ClNO3 and a molecular weight of 327.8 g/mol. IUPAC name: N-(5-chloro-2-methoxyphenyl)-3-hydroxynaphthalene-2-carboxamide. InChIKey: WWXPGBMLOCYWLD-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO3 |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | N-(5-chloro-2-methoxyphenyl)-3-hydroxynaphthalene-2-carboxamide |
| InChIKey | WWXPGBMLOCYWLD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)NC(=O)C2=CC3=CC=CC=C3C=C2O |
Computed by PubChem (NCBI)