CAS 93654-27-4 is the registry number for Ethyl 6-chloro-2-oxo-4-phenyl-1,2-dihydro-3-quinolinecarboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 6-chloro-2-oxo-4-phenyl-1H-quinoline-3-carboxylate (CAS 93654-27-4) is a chemical compound with the molecular formula C18H14ClNO3 and a molecular weight of 327.8 g/mol. IUPAC name: ethyl 6-chloro-2-oxo-4-phenyl-1H-quinoline-3-carboxylate. InChIKey: YNNAVLGZRMNKDA-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO3 |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | ethyl 6-chloro-2-oxo-4-phenyl-1H-quinoline-3-carboxylate |
| InChIKey | YNNAVLGZRMNKDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=CC(=C2)Cl)NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)