Products 554405-56-0
CAS 554405-56-0 is the registry number for 2-(3-Chlorophenyl)-4-(ethoxymethylidene)-1,2,3,4-tetrahydroisoquinoline-1,3-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
(4E)-2-(3-chlorophenyl)-4-(ethoxymethylidene)isoquinoline-1,3-dione (CAS 554405-56-0) is a chemical compound with the molecular formula C18H14ClNO3 and a molecular weight of 327.8 g/mol. IUPAC name: (4E)-2-(3-chlorophenyl)-4-(ethoxymethylidene)isoquinoline-1,3-dione. InChIKey: IKXRQCYRSYXSOF-LFIBNONCSA-N.
| Molecular formula | C18H14ClNO3 |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | (4E)-2-(3-chlorophenyl)-4-(ethoxymethylidene)isoquinoline-1,3-dione |
| InChIKey | IKXRQCYRSYXSOF-LFIBNONCSA-N |
| SMILES | CCO/C=C/1\C2=CC=CC=C2C(=O)N(C1=O)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)