CAS 1160430-66-9 appears in our catalog under these names: 6-(4-Chlorophenoxy)nicotinaldehyde, 95%, 95%, 6-(4-CHLOROPHENOXY)PYRIDINE-3-CARBALDEHYDE. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-(4-chlorophenoxy)pyridine-3-carbaldehyde (CAS 1160430-66-9) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 6-(4-chlorophenoxy)pyridine-3-carbaldehyde. InChIKey: SMZLJRHNWGOQOS-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 6-(4-chlorophenoxy)pyridine-3-carbaldehyde |
| InChIKey | SMZLJRHNWGOQOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=NC=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)