CAS 1160573-91-0 is the registry number for N-(2-Bromo-4-(tert-butyl)-6-nitrophenyl)acetamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
N-(2-bromo-4-tert-butyl-6-nitrophenyl)acetamide (CAS 1160573-91-0) is a chemical compound with the molecular formula C12H15BrN2O3 and a molecular weight of 315.16 g/mol. IUPAC name: N-(2-bromo-4-tert-butyl-6-nitrophenyl)acetamide. InChIKey: NXCVNQRTHNNHIN-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O3 |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | N-(2-bromo-4-tert-butyl-6-nitrophenyl)acetamide |
| InChIKey | NXCVNQRTHNNHIN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1Br)C(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)