CAS 1160720-50-2 is the registry number for Ethyl 2-amino-5-(2,2,2-trifluoroethyl)thiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2-amino-5-(2,2,2-trifluoroethyl)thiophene-3-carboxylate (CAS 1160720-50-2) is a chemical compound with the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. IUPAC name: ethyl 2-amino-5-(2,2,2-trifluoroethyl)thiophene-3-carboxylate. InChIKey: VSJQGYQNIZQQMW-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2S |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | ethyl 2-amino-5-(2,2,2-trifluoroethyl)thiophene-3-carboxylate |
| InChIKey | VSJQGYQNIZQQMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)CC(F)(F)F)N |
Computed by PubChem (NCBI)