CAS 1270412-47-9 is the registry number for 2,2,2-Trifluoro-1-(3-(methylsulfonyl)phenyl)ethan-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(3-methylsulfonylphenyl)ethanamine (CAS 1270412-47-9) is a chemical compound with the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-methylsulfonylphenyl)ethanamine. InChIKey: JYNBOCNHAFLSSP-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2S |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-methylsulfonylphenyl)ethanamine |
| InChIKey | JYNBOCNHAFLSSP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C(C(F)(F)F)N |
Computed by PubChem (NCBI)