Products 2758088-87-6
CAS 2758088-87-6 is the registry number for 3,5-Dimethyl-2-((trifluoromethyl)sulfonyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dimethyl-2-(trifluoromethylsulfonyl)aniline (CAS 2758088-87-6) is a chemical compound with the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. IUPAC name: 3,5-dimethyl-2-(trifluoromethylsulfonyl)aniline. InChIKey: LTKJEPMGBVYDHK-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2S |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | 3,5-dimethyl-2-(trifluoromethylsulfonyl)aniline |
| InChIKey | LTKJEPMGBVYDHK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)N)S(=O)(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)