CAS 1876746-56-3 is the registry number for Ethyl 4-methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 4-methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylate (CAS 1876746-56-3) is a chemical compound with the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. IUPAC name: ethyl 4-methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylate. InChIKey: WPVGQJVFOFIMRV-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2S |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | ethyl 4-methyl-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylate |
| InChIKey | WPVGQJVFOFIMRV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)CC(F)(F)F)C |
Computed by PubChem (NCBI)