CAS 116114-14-8 is the registry number for MDL 27266. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-chlorophenyl)-4-ethyl-2-methyl-1,2,4-triazol-3-one (CAS 116114-14-8) is a chemical compound with the molecular formula C11H12ClN3O and a molecular weight of 237.68 g/mol. IUPAC name: 5-(4-chlorophenyl)-4-ethyl-2-methyl-1,2,4-triazol-3-one. InChIKey: HXPJLBHKHCQJBB-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-4-ethyl-2-methyl-1,2,4-triazol-3-one |
| InChIKey | HXPJLBHKHCQJBB-UHFFFAOYSA-N |
| SMILES | CCN1C(=NN(C1=O)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)