CAS 116169-18-7 is the registry number for 3-Isopropyl 5-methyl 4-(benzo[c][1,2,5]oxadiazol-4-yl)-2,6-dimethylpyridine-3,5-dicarboxylate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-O-methyl 3-O-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethylpyridine-3,5-dicarboxylate (CAS 116169-18-7) is a chemical compound with the molecular formula C19H19N3O5 and a molecular weight of 369.4 g/mol. IUPAC name: 5-O-methyl 3-O-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethylpyridine-3,5-dicarboxylate. InChIKey: XXUCEEUFISNYCI-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 5-O-methyl 3-O-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| InChIKey | XXUCEEUFISNYCI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC(C)C)C2=CC=CC3=NON=C32)C(=O)OC |
Computed by PubChem (NCBI)