Products 1932248-63-9
CAS 1932248-63-9 appears in our catalog under these names: Fmoc-D-Alb-OH, Fmoc-D-Alb-OH, ≥95%, ≥95%. Offered by: Iris Biotech, Chemat. Available pack sizes: 250mg, 1g.
(2R)-3-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1932248-63-9) is a chemical compound with the molecular formula C19H19N3O5 and a molecular weight of 369.4 g/mol. IUPAC name: (2R)-3-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: XSICSLZBMDMQRC-MRXNPFEDSA-N.
| Molecular formula | C19H19N3O5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2R)-3-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | XSICSLZBMDMQRC-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CNC(=O)N)C(=O)O |
Computed by PubChem (NCBI)