Products 1257326-22-9
CAS 1257326-22-9 appears in our catalog under these names: NPEC-caged serotonin, NPEC–caged–serotonin. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 10mg, 50mg.
1-(2-nitrophenyl)ethyl N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate (CAS 1257326-22-9) is a chemical compound with the molecular formula C19H19N3O5 and a molecular weight of 369.4 g/mol. IUPAC name: 1-(2-nitrophenyl)ethyl N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate. InChIKey: KUEQXJVRVDFKJY-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 1-(2-nitrophenyl)ethyl N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate |
| InChIKey | KUEQXJVRVDFKJY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1[N+](=O)[O-])OC(=O)NCCC2=CNC3=C2C=C(C=C3)O |
Computed by PubChem (NCBI)