Products 327069-86-3

CAS 327069-86-3 is the registry number for 2-(2-(4-(Benzylamino)-4-oxobutanoyl)hydrazine-1-carbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[[4-(benzylamino)-4-oxobutanoyl]amino]carbamoyl]benzoic acid (CAS 327069-86-3) is a chemical compound with the molecular formula C19H19N3O5 and a molecular weight of 369.4 g/mol. IUPAC name: 2-[[[4-(benzylamino)-4-oxobutanoyl]amino]carbamoyl]benzoic acid. InChIKey: PRJJRDOHAGLXPT-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19N3O5
Molecular weight369.4 g/mol
IUPAC name2-[[[4-(benzylamino)-4-oxobutanoyl]amino]carbamoyl]benzoic acid
InChIKeyPRJJRDOHAGLXPT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CNC(=O)CCC(=O)NNC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)