CAS 1161742-89-7 is the registry number for (3S,4S)-Ethyl 1-boc-4-aminopyrrolidine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate (CAS 1161742-89-7) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate. InChIKey: AIZZFYPYPULRFL-DTWKUNHWSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate |
| InChIKey | AIZZFYPYPULRFL-DTWKUNHWSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)