CAS 895243-98-8 appears in our catalog under these names: (3R,4S)–1–tert–Butyl 3–ethyl 4–aminopyrrolidine–1,3–dicarboxylate, (3R,4S)-1-tert-Butyl 3-ethyl 4-aminopyrrolidine-1,3-dicarboxylate, 97%, 97%, (3R,4S)-1-tert-Butyl 3-ethyl 4-aminopyrrolidine-1,3-dicarboxylate, 98%, (3R,4S)-1-tert-Butyl 3-ethyl 4-aminopyrrolidine-1,3-dicarboxylate, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g.
1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopyrrolidine-1,3-dicarboxylate (CAS 895243-98-8) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopyrrolidine-1,3-dicarboxylate. InChIKey: AIZZFYPYPULRFL-RKDXNWHRSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopyrrolidine-1,3-dicarboxylate |
| InChIKey | AIZZFYPYPULRFL-RKDXNWHRSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C[C@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)