CAS 1161976-98-2 is the registry number for D-Allose-6-phosphate disodium. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
Disodium;[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate (CAS 1161976-98-2) is a chemical compound with the molecular formula C6H11Na2O9P and a molecular weight of 304.10 g/mol. IUPAC name: disodium;[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate. InChIKey: VQLXCAHGUGIEEL-GWGZLDMPSA-L.
| Molecular formula | C6H11Na2O9P |
|---|---|
| Molecular weight | 304.10 g/mol |
| IUPAC name | disodium;[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate |
| InChIKey | VQLXCAHGUGIEEL-GWGZLDMPSA-L |
| SMILES | C([C@H]([C@H]([C@H]([C@H](C=O)O)O)O)O)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)