CAS 56401-20-8 appears in our catalog under these names: Alpha-d-glucose-1-phosphate disodium salt tetrahydrate, 95%, alpha-D-Glucose 1-phosphate Disodium Salt, a-D-Glucose 1-Phosphate Disodium Salt Tetrahydrate, >95% (HPLC), Alpha-D-Glucose 1-Phosphate Disodium Salt Tetrahydrate, >95% (HPLC), α-D-Glucose-1-phosphate disodium/ 99.84% (existing batch purity). Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 5g, 25g, 1g, on request, 10g, 50mg, 100mg, 200mg.
Disodium;[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (CAS 56401-20-8) is a chemical compound with the molecular formula C6H11Na2O9P and a molecular weight of 304.10 g/mol. IUPAC name: disodium;[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate. InChIKey: DCOZWBXYGZXXRX-PKXGBZFFSA-L.
| Molecular formula | C6H11Na2O9P |
|---|---|
| Molecular weight | 304.10 g/mol |
| IUPAC name | disodium;[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| InChIKey | DCOZWBXYGZXXRX-PKXGBZFFSA-L |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OP(=O)([O-])[O-])O)O)O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)