CAS 147072-63-7 appears in our catalog under these names: D-Galactose-1-phosphate disodium salt, 95%, D-Galactose-1-phosphate disodium. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg.
Disodium;[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (CAS 147072-63-7) is a chemical compound with the molecular formula C6H11Na2O9P and a molecular weight of 304.10 g/mol. IUPAC name: disodium;[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate. InChIKey: DCOZWBXYGZXXRX-IOMCPNLXSA-L.
| Molecular formula | C6H11Na2O9P |
|---|---|
| Molecular weight | 304.10 g/mol |
| IUPAC name | disodium;[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| InChIKey | DCOZWBXYGZXXRX-IOMCPNLXSA-L |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H](C(O1)OP(=O)([O-])[O-])O)O)O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)