CAS 83833-15-2 appears in our catalog under these names: β-D-Glucose-1-phosphate disodium, min. 95 %, 2 mg, Beta-d-glucopyranose 1-phosphate disodium salt, 95%, beta-D-Glucopyranose 1-Phosphate Disodium Salt, 98% HPLC, β–D–Glucopyranose 1–Phosphate Disodium Salt, β-D-Glucose-1-phosphate disodium. Offered by: Roth, Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 2mg, 100mg, 20mg, 5mg, 10mg, 50mg, 25mg, 5 mg.
Disodium;[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (CAS 83833-15-2) is a chemical compound with the molecular formula C6H11Na2O9P and a molecular weight of 304.10 g/mol. IUPAC name: disodium;[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate. InChIKey: DCOZWBXYGZXXRX-UZUGEDCSSA-L.
| Molecular formula | C6H11Na2O9P |
|---|---|
| Molecular weight | 304.10 g/mol |
| IUPAC name | disodium;[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| InChIKey | DCOZWBXYGZXXRX-UZUGEDCSSA-L |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OP(=O)([O-])[O-])O)O)O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)