Products 116297-12-2
CAS 116297-12-2 appears in our catalog under these names: (S)-(-)-N-Isopropyl-1-phenylethylamine hydrochloride, 95%, (S)-N-(1-Phenylethyl)propan-2-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg.
N-[(1S)-1-phenylethyl]propan-2-amine;hydrochloride (CAS 116297-12-2) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: N-[(1S)-1-phenylethyl]propan-2-amine;hydrochloride. InChIKey: SVRDLWQPQZOASL-PPHPATTJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | N-[(1S)-1-phenylethyl]propan-2-amine;hydrochloride |
| InChIKey | SVRDLWQPQZOASL-PPHPATTJSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(C)C.Cl |
Computed by PubChem (NCBI)