Products 1163141-52-3
CAS 1163141-52-3 appears in our catalog under these names: 3-Hydroxy-5-(trifluoromethoxy)benzoic acid, 3-Hydroxy-5-(trifluoromethoxy)benzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-hydroxy-5-(trifluoromethoxy)benzoic acid (CAS 1163141-52-3) is a chemical compound with the molecular formula C8H5F3O4 and a molecular weight of 222.12 g/mol. IUPAC name: 3-hydroxy-5-(trifluoromethoxy)benzoic acid. InChIKey: ODXFYLCLJCPTLB-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O4 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 3-hydroxy-5-(trifluoromethoxy)benzoic acid |
| InChIKey | ODXFYLCLJCPTLB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)