Products 851341-57-6

CAS 851341-57-6 is the registry number for 5-Hydroxy-2-(trifluoromethoxy)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

5-hydroxy-2-(trifluoromethoxy)benzoic acid (CAS 851341-57-6) is a chemical compound with the molecular formula C8H5F3O4 and a molecular weight of 222.12 g/mol. IUPAC name: 5-hydroxy-2-(trifluoromethoxy)benzoic acid. InChIKey: VMWFNEUPJINUMV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3O4
Molecular weight222.12 g/mol
IUPAC name5-hydroxy-2-(trifluoromethoxy)benzoic acid
InChIKeyVMWFNEUPJINUMV-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1O)C(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)