CAS 773873-50-0 appears in our catalog under these names: 2-Hydroxy-3-(trifluoromethoxy)benzoic acid, 97%, 97%, 2-Hydroxy-3-(trifluoromethoxy)benzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g.
2-hydroxy-3-(trifluoromethoxy)benzoic acid (CAS 773873-50-0) is a chemical compound with the molecular formula C8H5F3O4 and a molecular weight of 222.12 g/mol. IUPAC name: 2-hydroxy-3-(trifluoromethoxy)benzoic acid. InChIKey: SDFAGXLFYRIEBD-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O4 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 2-hydroxy-3-(trifluoromethoxy)benzoic acid |
| InChIKey | SDFAGXLFYRIEBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)