CAS 851341-56-5 is the registry number for 4-Hydroxy-2-(trifluoromethoxy)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-hydroxy-2-(trifluoromethoxy)benzoic acid (CAS 851341-56-5) is a chemical compound with the molecular formula C8H5F3O4 and a molecular weight of 222.12 g/mol. IUPAC name: 4-hydroxy-2-(trifluoromethoxy)benzoic acid. InChIKey: ZANWUIYWWRDBJW-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O4 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 4-hydroxy-2-(trifluoromethoxy)benzoic acid |
| InChIKey | ZANWUIYWWRDBJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)