CAS 1163280-59-8 is the registry number for 4-(3-Methoxypropyl)-2,2-dimethyl-3-oxo-3,4-dihydro-2h-1,4-benzoxazine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(3-methoxypropyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxylic acid (CAS 1163280-59-8) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 4-(3-methoxypropyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxylic acid. InChIKey: TVJJKCSXQONSPZ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO5 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | 4-(3-methoxypropyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxylic acid |
| InChIKey | TVJJKCSXQONSPZ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C2=C(O1)C=CC(=C2)C(=O)O)CCCOC)C |
Computed by PubChem (NCBI)