Products 162504-85-0

CAS 162504-85-0 appears in our catalog under these names: 4-Carboxymethoxy-piperidine-1-carboxylic acid benzyl ester, 98%, 2-((1-((Benzyloxy)carbonyl)piperidin-4-yl)oxy)acetic acid, 98%, 4-Carboxymethoxy-piperidine-1-carboxylic acid benzyl ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.

Structural formula: {0} (CAS {1})

2-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyacetic acid (CAS 162504-85-0) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 2-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyacetic acid. InChIKey: WMFVDLNUEFUSES-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO5
Molecular weight293.31 g/mol
IUPAC name2-(1-phenylmethoxycarbonylpiperidin-4-yl)oxyacetic acid
InChIKeyWMFVDLNUEFUSES-UHFFFAOYSA-N
SMILESC1CN(CCC1OCC(=O)O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)