CAS 1259323-78-8 appears in our catalog under these names: 4-([1-(tert-Butoxycarbonyl)azetidin-3-yl]oxy)benzoic acid, 95%, 4-((1-(tert-Butoxycarbonyl)azetidin-3-yl)oxy)benzoic acid, 95%, 4-((1-(tert-Butoxycarbonyl)azetidin-3-Yl)oxy)benzoic Acid, 4-{(1-(tert-Butoxycarbonyl)azetidin-3-yl)oxy}benzoic acid, 1-Azetidinecarboxylic acid, 3-(4-carboxyphenoxy)-, 1-(1,1-dimethylethyl) ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, TRC, Biosynth, Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 100mg, 10g.
4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid (CAS 1259323-78-8) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid. InChIKey: BWILLSLXSIKGTH-UHFFFAOYSA-N.
| Molecular formula | C15H19NO5 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid |
| InChIKey | BWILLSLXSIKGTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)