Products 116480-86-5
CAS 116480-86-5 is the registry number for Boc-d-valine-l-phe-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 2g, 1g.
(2S)-2-[[(2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-phenylpropanoic acid (CAS 116480-86-5) is a chemical compound with the molecular formula C19H28N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: (2S)-2-[[(2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-phenylpropanoic acid. InChIKey: CCPXIFCBNOUEBC-LSDHHAIUSA-N.
| Molecular formula | C19H28N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | (2S)-2-[[(2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | CCPXIFCBNOUEBC-LSDHHAIUSA-N |
| SMILES | CC(C)[C@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)