CAS 91374-24-2 appears in our catalog under these names: Ethyl 2-(2-(Dipropylamino)ethyl)-6-nitrophenyl Pyruvate, Ropinirole Impurity 1. Offered by: TRC, Chemat Brand. Available pack sizes: 25mg, on request.
Ethyl 3-[2-[2-(dipropylamino)ethyl]-6-nitrophenyl]-2-oxopropanoate (CAS 91374-24-2) is a chemical compound with the molecular formula C19H28N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: ethyl 3-[2-[2-(dipropylamino)ethyl]-6-nitrophenyl]-2-oxopropanoate. InChIKey: WOOIUFZMYXSJNR-UHFFFAOYSA-N.
| Molecular formula | C19H28N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | ethyl 3-[2-[2-(dipropylamino)ethyl]-6-nitrophenyl]-2-oxopropanoate |
| InChIKey | WOOIUFZMYXSJNR-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CCC1=C(C(=CC=C1)[N+](=O)[O-])CC(=O)C(=O)OCC |
Computed by PubChem (NCBI)