CAS 72468-46-3 is the registry number for (S)-Benzyl 2-((tert-butoxycarbonyl)amino)-5-(dimethylamino)-5-oxopentanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Benzyl (2S)-5-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (CAS 72468-46-3) is a chemical compound with the molecular formula C19H28N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: benzyl (2S)-5-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate. InChIKey: PUAXRJKHHACRHI-HNNXBMFYSA-N.
| Molecular formula | C19H28N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | benzyl (2S)-5-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| InChIKey | PUAXRJKHHACRHI-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)N(C)C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)